C17H16ClF — CID 81477360
5-[chloro-(2-fluoro-3-methylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 81477360) has the molecular formula C17H16ClF and a molecular weight of 274.77 g/mol. Its IUPAC name is 5-[chloro-(2-fluoro-3-methylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(2-fluoro-3-methylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 81477360 |
| Molecular Formula | C17H16ClF |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-[chloro-(2-fluoro-3-methylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Cc1cccc(C(Cl)c2ccc3c(c2)CCC3)c1F |
| InChI | InChI=1S/C17H16ClF/c1-11-4-2-7-15(17(11)19)16(18)14-9-8-12-5-3-6-13(12)10-14/h2,4,7-10,16H,3,5-6H2,1H3 |
| InChIKey | JCGDEUGUNNYHDI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|