C17H15Br2Cl — CID 81473689
5-[chloro-(2,5-dibromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 81473689) has the molecular formula C17H15Br2Cl and a molecular weight of 414.57 g/mol. Its IUPAC name is 5-[chloro-(2,5-dibromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(2,5-dibromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 81473689 |
| Molecular Formula | C17H15Br2Cl |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 5-[chloro-(2,5-dibromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Cc1cc(Br)c(C(Cl)c2ccc3c(c2)CCC3)cc1Br |
| InChI | InChI=1S/C17H15Br2Cl/c1-10-7-16(19)14(9-15(10)18)17(20)13-6-5-11-3-2-4-12(11)8-13/h5-9,17H,2-4H2,1H3 |
| InChIKey | QOUAJGUSRSZPDB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|