C17H16Br2 — CID 81476485
5-[bromo-(3-bromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 81476485) has the molecular formula C17H16Br2 and a molecular weight of 380.12 g/mol. Its IUPAC name is 5-[bromo-(3-bromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[bromo-(3-bromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 81476485 |
| Molecular Formula | C17H16Br2 |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 5-[bromo-(3-bromo-4-methylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Cc1ccc(C(Br)c2ccc3c(c2)CCC3)cc1Br |
| InChI | InChI=1S/C17H16Br2/c1-11-5-6-15(10-16(11)18)17(19)14-8-7-12-3-2-4-13(12)9-14/h5-10,17H,2-4H2,1H3 |
| InChIKey | FSGCCBLPUPFOGT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|