C18H19ClO — CID 63430106
5-[chloro-(4-methoxy-2-methylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 63430106) has the molecular formula C18H19ClO and a molecular weight of 286.80 g/mol. Its IUPAC name is 5-[chloro-(4-methoxy-2-methylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(4-methoxy-2-methylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63430106 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[chloro-(4-methoxy-2-methylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(C(Cl)c2ccc3c(c2)CCC3)c(C)c1 |
| InChI | InChI=1S/C18H19ClO/c1-12-10-16(20-2)8-9-17(12)18(19)15-7-6-13-4-3-5-14(13)11-15/h6-11,18H,3-5H2,1-2H3 |
| InChIKey | AAEYDUMPYXFCTG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|