C17H17ClO2 — CID 61082278
(2-chloro-4-methoxyphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol (PubChem CID 61082278) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is (2-chloro-4-methoxyphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol.
| Compound Name | (2-chloro-4-methoxyphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol |
|---|---|
| PubChem CID | 61082278 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (2-chloro-4-methoxyphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol |
| SMILES | COc1ccc(C(O)c2ccc3c(c2)CCC3)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClO2/c1-20-14-7-8-15(16(18)10-14)17(19)13-6-5-11-3-2-4-12(11)9-13/h5-10,17,19H,2-4H2,1H3 |
| InChIKey | WRPDOZPVRQGPHS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |