C17H18OS — CID 79217290
2,3-dihydro-1H-inden-5-yl-(2-methylsulfanylphenyl)methanol (PubChem CID 79217290) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(2-methylsulfanylphenyl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(2-methylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 79217290 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(2-methylsulfanylphenyl)methanol |
| SMILES | CSc1ccccc1C(O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18OS/c1-19-16-8-3-2-7-15(16)17(18)14-10-9-12-5-4-6-13(12)11-14/h2-3,7-11,17-18H,4-6H2,1H3 |
| InChIKey | DOLPSDNPFRXWEY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |