C18H16OS — CID 61087821
1-benzothiophen-3-yl(2,3-dihydro-1H-inden-5-yl)methanol (PubChem CID 61087821) has the molecular formula C18H16OS and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-benzothiophen-3-yl(2,3-dihydro-1H-inden-5-yl)methanol.
| Compound Name | 1-benzothiophen-3-yl(2,3-dihydro-1H-inden-5-yl)methanol |
|---|---|
| PubChem CID | 61087821 |
| Molecular Formula | C18H16OS |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-benzothiophen-3-yl(2,3-dihydro-1H-inden-5-yl)methanol |
| SMILES | OC(c1ccc2c(c1)CCC2)c1csc2ccccc12 |
| InChI | InChI=1S/C18H16OS/c19-18(14-9-8-12-4-3-5-13(12)10-14)16-11-20-17-7-2-1-6-15(16)17/h1-2,6-11,18-19H,3-5H2 |
| InChIKey | KCJWMGYKZSISKL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |