C16H13ClS2 — CID 63433097
3-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-benzothiophene (PubChem CID 63433097) has the molecular formula C16H13ClS2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 3-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-benzothiophene.
| Compound Name | 3-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 63433097 |
| Molecular Formula | C16H13ClS2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-benzothiophene |
| SMILES | ClC(c1cc2c(s1)CCC2)c1csc2ccccc12 |
| InChI | InChI=1S/C16H13ClS2/c17-16(15-8-10-4-3-7-13(10)19-15)12-9-18-14-6-2-1-5-11(12)14/h1-2,5-6,8-9,16H,3-4,7H2 |
| InChIKey | JPAVEBHFWXNUQF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|