C15H14ClFOS — CID 63434342
2-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63434342) has the molecular formula C15H14ClFOS and a molecular weight of 296.79 g/mol. Its IUPAC name is 2-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63434342 |
| Molecular Formula | C15H14ClFOS |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | COc1ccc(C(Cl)c2cc3c(s2)CCC3)c(F)c1 |
| InChI | InChI=1S/C15H14ClFOS/c1-18-10-5-6-11(12(17)8-10)15(16)14-7-9-3-2-4-13(9)19-14/h5-8,15H,2-4H2,1H3 |
| InChIKey | UQIMRQPWDHWHBQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|