C14H11Br2ClS — CID 63429641
2-[chloro-(2,5-dibromophenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63429641) has the molecular formula C14H11Br2ClS and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[chloro-(2,5-dibromophenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[chloro-(2,5-dibromophenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63429641 |
| Molecular Formula | C14H11Br2ClS |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 403.86 |
| IUPAC Name | 2-[chloro-(2,5-dibromophenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | ClC(c1cc2c(s1)CCC2)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H11Br2ClS/c15-9-4-5-11(16)10(7-9)14(17)13-6-8-2-1-3-12(8)18-13/h4-7,14H,1-3H2 |
| InChIKey | BWVNXJKNXACPIL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|