C18H14BrClS — CID 79591148
2-[(4-bromonaphthalen-1-yl)-chloromethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 79591148) has the molecular formula C18H14BrClS and a molecular weight of 377.73 g/mol. Its IUPAC name is 2-[(4-bromonaphthalen-1-yl)-chloromethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[(4-bromonaphthalen-1-yl)-chloromethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 79591148 |
| Molecular Formula | C18H14BrClS |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-[(4-bromonaphthalen-1-yl)-chloromethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | ClC(c1cc2c(s1)CCC2)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C18H14BrClS/c19-15-9-8-14(12-5-1-2-6-13(12)15)18(20)17-10-11-4-3-7-16(11)21-17/h1-2,5-6,8-10,18H,3-4,7H2 |
| InChIKey | BPGGLFUCEVXTIM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|