C16H16Cl2O2S — CID 63432858
2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63432858) has the molecular formula C16H16Cl2O2S and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63432858 |
| Molecular Formula | C16H16Cl2O2S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | COc1cc(Cl)c(C(Cl)c2cc3c(s2)CCC3)cc1OC |
| InChI | InChI=1S/C16H16Cl2O2S/c1-19-12-7-10(11(17)8-13(12)20-2)16(18)15-6-9-4-3-5-14(9)21-15/h6-8,16H,3-5H2,1-2H3 |
| InChIKey | YKUNCPXZBHXLSY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|