C18H21ClOS — CID 63443871
2-[chloro-(2-ethoxy-5-methylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 63443871) has the molecular formula C18H21ClOS and a molecular weight of 320.89 g/mol. Its IUPAC name is 2-[chloro-(2-ethoxy-5-methylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[chloro-(2-ethoxy-5-methylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 63443871 |
| Molecular Formula | C18H21ClOS |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[chloro-(2-ethoxy-5-methylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | CCOc1ccc(C)cc1C(Cl)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H21ClOS/c1-3-20-15-9-8-12(2)10-14(15)18(19)17-11-13-6-4-5-7-16(13)21-17/h8-11,18H,3-7H2,1-2H3 |
| InChIKey | HZJVFRSXXKMKKB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|