C18H21BrOS — CID 63436925
2-[bromo-(4-ethoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene (PubChem CID 63436925) has the molecular formula C18H21BrOS and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-[bromo-(4-ethoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene.
| Compound Name | 2-[bromo-(4-ethoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 63436925 |
| Molecular Formula | C18H21BrOS |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[bromo-(4-ethoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
| SMILES | CCOc1ccc(C(Br)c2cc3c(s2)CCCCC3)cc1 |
| InChI | InChI=1S/C18H21BrOS/c1-2-20-15-10-8-13(9-11-15)18(19)17-12-14-6-4-3-5-7-16(14)21-17/h8-12,18H,2-7H2,1H3 |
| InChIKey | CGTSFELFDUNTDY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|