C16H17BrS2 — CID 81260684
2-[bromo-(4-ethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81260684) has the molecular formula C16H17BrS2 and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[bromo-(4-ethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[bromo-(4-ethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81260684 |
| Molecular Formula | C16H17BrS2 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-[bromo-(4-ethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | CCc1ccc(C(Br)c2cc3c(s2)CCSC3)cc1 |
| InChI | InChI=1S/C16H17BrS2/c1-2-11-3-5-12(6-4-11)16(17)15-9-13-10-18-8-7-14(13)19-15/h3-6,9,16H,2,7-8,10H2,1H3 |
| InChIKey | GSENVZWYOANGOR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|