C15H14BrNO2S2 — CID 81267513
2-[1-bromo-2-(4-nitrophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81267513) has the molecular formula C15H14BrNO2S2 and a molecular weight of 384.32 g/mol. Its IUPAC name is 2-[1-bromo-2-(4-nitrophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[1-bromo-2-(4-nitrophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81267513 |
| Molecular Formula | C15H14BrNO2S2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 2-[1-bromo-2-(4-nitrophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | O=[N+]([O-])c1ccc(CC(Br)c2cc3c(s2)CCSC3)cc1 |
| InChI | InChI=1S/C15H14BrNO2S2/c16-13(7-10-1-3-12(4-2-10)17(18)19)15-8-11-9-20-6-5-14(11)21-15/h1-4,8,13H,5-7,9H2 |
| InChIKey | ZWKJUAKROMOPJC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|