C16H16BrNO2S — CID 63544677
2-[1-bromo-2-(4-nitrophenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 63544677) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is 2-[1-bromo-2-(4-nitrophenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[1-bromo-2-(4-nitrophenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 63544677 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-[1-bromo-2-(4-nitrophenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | O=[N+]([O-])c1ccc(CC(Br)c2cc3c(s2)CCCC3)cc1 |
| InChI | InChI=1S/C16H16BrNO2S/c17-14(9-11-5-7-13(8-6-11)18(19)20)16-10-12-3-1-2-4-15(12)21-16/h5-8,10,14H,1-4,9H2 |
| InChIKey | OGVAFFHYXLVZEV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|