About 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline
2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline (PubChem CID 66459039) has the molecular formula C18H16BrNS
and a molecular weight of 358.30 g/mol. Its IUPAC name is 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline.
Molecular Properties
| Compound Name | 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline |
| PubChem CID | 66459039 |
| Molecular Formula | C18H16BrNS |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline |
| SMILES | BrC(Cc1ccc2ccccc2n1)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C18H16BrNS/c19-15(18-10-13-5-3-7-17(13)21-18)11-14-9-8-12-4-1-2-6-16(12)20-14/h1-2,4,6,8-10,15H,3,5,7,11H2 |
| InChIKey | AWJUTTNFMHAFMH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline?
The IUPAC name of 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline (CID 66459039) is 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline.
What is the SMILES notation for 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline?
The canonical SMILES for 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline is BrC(Cc1ccc2ccccc2n1)c1cc2c(s1)CCC2.
What is the InChIKey of 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline?
The InChIKey is AWJUTTNFMHAFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrNS/c19-15(18-10-13-5-3-7-17(13)21-18)11-14-9-8-12-4-1-2-6-16(12)20-14/h1-2,4,6,8-10,15H,3,5,7,11H2.
What are the key properties of 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline?
2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline has a molecular weight of 358.30 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline is sourced from PubChem (CID 66459039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).