C15H13BrCl2S — CID 63530771
2-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63530771) has the molecular formula C15H13BrCl2S and a molecular weight of 376.15 g/mol. Its IUPAC name is 2-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63530771 |
| Molecular Formula | C15H13BrCl2S |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 2-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | Clc1ccc(CC(Br)c2cc3c(s2)CCC3)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2S/c16-11(6-9-4-5-12(17)13(18)7-9)15-8-10-2-1-3-14(10)19-15/h4-5,7-8,11H,1-3,6H2 |
| InChIKey | XZQGFYMJVOOSSP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|