C14H15BrS2 — CID 55224080
2-(1-bromo-2-thiophen-2-ylethyl)-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 55224080) has the molecular formula C14H15BrS2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-(1-bromo-2-thiophen-2-ylethyl)-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-(1-bromo-2-thiophen-2-ylethyl)-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 55224080 |
| Molecular Formula | C14H15BrS2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-(1-bromo-2-thiophen-2-ylethyl)-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | BrC(Cc1cccs1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H15BrS2/c15-12(9-11-5-3-7-16-11)14-8-10-4-1-2-6-13(10)17-14/h3,5,7-8,12H,1-2,4,6,9H2 |
| InChIKey | FKEWTLKSQPCORT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|