C16H18BrNS — CID 66454396
2-[2-bromo-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethyl]pyridine (PubChem CID 66454396) has the molecular formula C16H18BrNS and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[2-bromo-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethyl]pyridine.
| Compound Name | 2-[2-bromo-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 66454396 |
| Molecular Formula | C16H18BrNS |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[2-bromo-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethyl]pyridine |
| SMILES | BrC(Cc1ccccn1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C16H18BrNS/c17-14(11-13-7-4-5-9-18-13)16-10-12-6-2-1-3-8-15(12)19-16/h4-5,7,9-10,14H,1-3,6,8,11H2 |
| InChIKey | DYZDVLMELVHRKD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|