C15H17BrS2 — CID 63542210
2-(1-bromo-2-thiophen-3-ylethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene (PubChem CID 63542210) has the molecular formula C15H17BrS2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-(1-bromo-2-thiophen-3-ylethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene.
| Compound Name | 2-(1-bromo-2-thiophen-3-ylethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 63542210 |
| Molecular Formula | C15H17BrS2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-(1-bromo-2-thiophen-3-ylethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
| SMILES | BrC(Cc1ccsc1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C15H17BrS2/c16-13(8-11-6-7-17-10-11)15-9-12-4-2-1-3-5-14(12)18-15/h6-7,9-10,13H,1-5,8H2 |
| InChIKey | OUOKAZNFACLMQE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|