C18H16ClNS — CID 66459340
2-[2-chloro-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline (PubChem CID 66459340) has the molecular formula C18H16ClNS and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-[2-chloro-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline.
| Compound Name | 2-[2-chloro-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline |
|---|---|
| PubChem CID | 66459340 |
| Molecular Formula | C18H16ClNS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[2-chloro-2-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]quinoline |
| SMILES | ClC(Cc1ccc2ccccc2n1)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C18H16ClNS/c19-15(18-10-13-5-3-7-17(13)21-18)11-14-9-8-12-4-1-2-6-16(12)20-14/h1-2,4,6,8-10,15H,3,5,7,11H2 |
| InChIKey | RVIFOQHEMNSGQG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|