C17H19BrOS — CID 63438030
2-[bromo-[4-(2-methoxyethyl)phenyl]methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63438030) has the molecular formula C17H19BrOS and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-[bromo-[4-(2-methoxyethyl)phenyl]methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[bromo-[4-(2-methoxyethyl)phenyl]methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63438030 |
| Molecular Formula | C17H19BrOS |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-[bromo-[4-(2-methoxyethyl)phenyl]methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | COCCc1ccc(C(Br)c2cc3c(s2)CCC3)cc1 |
| InChI | InChI=1S/C17H19BrOS/c1-19-10-9-12-5-7-13(8-6-12)17(18)16-11-14-3-2-4-15(14)20-16/h5-8,11,17H,2-4,9-10H2,1H3 |
| InChIKey | CLMSEKQRBKJGOS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|