C17H18BrFS — CID 65296618
2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 65296618) has the molecular formula C17H18BrFS and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 65296618 |
| Molecular Formula | C17H18BrFS |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[bromo-(4-fluoro-3,5-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | Cc1cc(C(Br)c2cc3c(s2)CCCC3)cc(C)c1F |
| InChI | InChI=1S/C17H18BrFS/c1-10-7-13(8-11(2)17(10)19)16(18)15-9-12-5-3-4-6-14(12)20-15/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | PWHSGSGDQSSVSM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|