C13H12BrClS2 — CID 63441386
2-[bromo-(5-chlorothiophen-2-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 63441386) has the molecular formula C13H12BrClS2 and a molecular weight of 347.73 g/mol. Its IUPAC name is 2-[bromo-(5-chlorothiophen-2-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[bromo-(5-chlorothiophen-2-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 63441386 |
| Molecular Formula | C13H12BrClS2 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-[bromo-(5-chlorothiophen-2-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | Clc1ccc(C(Br)c2cc3c(s2)CCCC3)s1 |
| InChI | InChI=1S/C13H12BrClS2/c14-13(10-5-6-12(15)17-10)11-7-8-3-1-2-4-9(8)16-11/h5-7,13H,1-4H2 |
| InChIKey | CKHWASFSGGSUFX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|