C17H18BrClOS — CID 63443070
2-[bromo-(2-chloro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene (PubChem CID 63443070) has the molecular formula C17H18BrClOS and a molecular weight of 385.75 g/mol. Its IUPAC name is 2-[bromo-(2-chloro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene.
| Compound Name | 2-[bromo-(2-chloro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 63443070 |
| Molecular Formula | C17H18BrClOS |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 2-[bromo-(2-chloro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene |
| SMILES | COc1ccc(C(Br)c2cc3c(s2)CCCCC3)c(Cl)c1 |
| InChI | InChI=1S/C17H18BrClOS/c1-20-12-7-8-13(14(19)10-12)17(18)16-9-11-5-3-2-4-6-15(11)21-16/h7-10,17H,2-6H2,1H3 |
| InChIKey | MGZUNLIGBSKZQA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|