C16H17ClOS — CID 63520431
2-[1-chloro-2-(4-methoxyphenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63520431) has the molecular formula C16H17ClOS and a molecular weight of 292.83 g/mol. Its IUPAC name is 2-[1-chloro-2-(4-methoxyphenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[1-chloro-2-(4-methoxyphenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63520431 |
| Molecular Formula | C16H17ClOS |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[1-chloro-2-(4-methoxyphenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | COc1ccc(CC(Cl)c2cc3c(s2)CCC3)cc1 |
| InChI | InChI=1S/C16H17ClOS/c1-18-13-7-5-11(6-8-13)9-14(17)16-10-12-3-2-4-15(12)19-16/h5-8,10,14H,2-4,9H2,1H3 |
| InChIKey | MQWXCRRVKXKAAU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|