C14H10BrClOS2 — CID 80745326
5-[bromo-(2-chloro-4-methoxyphenyl)methyl]thieno[3,2-b]thiophene (PubChem CID 80745326) has the molecular formula C14H10BrClOS2 and a molecular weight of 373.72 g/mol. Its IUPAC name is 5-[bromo-(2-chloro-4-methoxyphenyl)methyl]thieno[3,2-b]thiophene.
| Compound Name | 5-[bromo-(2-chloro-4-methoxyphenyl)methyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 80745326 |
| Molecular Formula | C14H10BrClOS2 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 5-[bromo-(2-chloro-4-methoxyphenyl)methyl]thieno[3,2-b]thiophene |
| SMILES | COc1ccc(C(Br)c2cc3sccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrClOS2/c1-17-8-2-3-9(10(16)6-8)14(15)13-7-12-11(19-13)4-5-18-12/h2-7,14H,1H3 |
| InChIKey | FMNPOYRXCKWJSZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|