C11H5BrCl2S3 — CID 80744838
5-[bromo-(2,5-dichlorothiophen-3-yl)methyl]thieno[3,2-b]thiophene (PubChem CID 80744838) has the molecular formula C11H5BrCl2S3 and a molecular weight of 384.17 g/mol. Its IUPAC name is 5-[bromo-(2,5-dichlorothiophen-3-yl)methyl]thieno[3,2-b]thiophene.
| Compound Name | 5-[bromo-(2,5-dichlorothiophen-3-yl)methyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 80744838 |
| Molecular Formula | C11H5BrCl2S3 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 381.81 |
| IUPAC Name | 5-[bromo-(2,5-dichlorothiophen-3-yl)methyl]thieno[3,2-b]thiophene |
| SMILES | Clc1cc(C(Br)c2cc3sccc3s2)c(Cl)s1 |
| InChI | InChI=1S/C11H5BrCl2S3/c12-10(5-3-9(13)17-11(5)14)8-4-7-6(16-8)1-2-15-7/h1-4,10H |
| InChIKey | VMTZAIYAXPGLFR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|