C14H9Br2FOS2 — CID 103396524
5-[bromo-(5-bromo-4-fluoro-2-methoxyphenyl)methyl]thieno[3,2-b]thiophene (PubChem CID 103396524) has the molecular formula C14H9Br2FOS2 and a molecular weight of 436.17 g/mol. Its IUPAC name is 5-[bromo-(5-bromo-4-fluoro-2-methoxyphenyl)methyl]thieno[3,2-b]thiophene.
| Compound Name | 5-[bromo-(5-bromo-4-fluoro-2-methoxyphenyl)methyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 103396524 |
| Molecular Formula | C14H9Br2FOS2 |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 433.84 |
| IUPAC Name | 5-[bromo-(5-bromo-4-fluoro-2-methoxyphenyl)methyl]thieno[3,2-b]thiophene |
| SMILES | COc1cc(F)c(Br)cc1C(Br)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H9Br2FOS2/c1-18-10-5-9(17)8(15)4-7(10)14(16)13-6-12-11(20-13)2-3-19-12/h2-6,14H,1H3 |
| InChIKey | INDADLMSCJBFPY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|