C15H12Cl2O2S2 — CID 80738911
5-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thieno[3,2-b]thiophene (PubChem CID 80738911) has the molecular formula C15H12Cl2O2S2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 5-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thieno[3,2-b]thiophene.
| Compound Name | 5-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 80738911 |
| Molecular Formula | C15H12Cl2O2S2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thieno[3,2-b]thiophene |
| SMILES | COc1cc(Cl)c(C(Cl)c2cc3sccc3s2)cc1OC |
| InChI | InChI=1S/C15H12Cl2O2S2/c1-18-10-5-8(9(16)6-11(10)19-2)15(17)14-7-13-12(21-14)3-4-20-13/h3-7,15H,1-2H3 |
| InChIKey | NGPWDRKNMJZQKZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|