C14H11ClO2S2 — CID 104546249
(5-chloro-2-methoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 104546249) has the molecular formula C14H11ClO2S2 and a molecular weight of 310.83 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | (5-chloro-2-methoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 104546249 |
| Molecular Formula | C14H11ClO2S2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | COc1ccc(Cl)cc1C(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H11ClO2S2/c1-17-10-3-2-8(15)6-9(10)14(16)13-7-12-11(19-13)4-5-18-12/h2-7,14,16H,1H3 |
| InChIKey | HXHQEYIHCXNSIR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |