C16H14BrNO2S — CID 62300212
6-[bromo(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 62300212) has the molecular formula C16H14BrNO2S and a molecular weight of 364.26 g/mol. Its IUPAC name is 6-[bromo(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62300212 |
| Molecular Formula | C16H14BrNO2S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 6-[bromo(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(Br)c3cc4c(s3)CCC4)ccc21 |
| InChI | InChI=1S/C16H14BrNO2S/c1-18-11-6-5-10(7-12(11)20-16(18)19)15(17)14-8-9-3-2-4-13(9)21-14/h5-8,15H,2-4H2,1H3 |
| InChIKey | LASOCMSQUSYCEE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|