C11H13BrN2O2 — CID 116915103
6-[bromo(dimethylamino)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116915103) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 6-[bromo(dimethylamino)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo(dimethylamino)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116915103 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 6-[bromo(dimethylamino)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CN(C)C(Br)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C11H13BrN2O2/c1-13(2)10(12)7-4-5-8-9(6-7)16-11(15)14(8)3/h4-6,10H,1-3H3 |
| InChIKey | LPLISFXOQKCTKY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|