C11H14N2O3 — CID 116961538
6-[methoxy(methylamino)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116961538) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 6-[methoxy(methylamino)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[methoxy(methylamino)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116961538 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 6-[methoxy(methylamino)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CNC(OC)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C11H14N2O3/c1-12-10(15-3)7-4-5-8-9(6-7)16-11(14)13(8)2/h4-6,10,12H,1-3H3 |
| InChIKey | IAHWPSJXSNADOM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|