C14H21N3O2 — CID 116949489
6-[1,4-bis(methylamino)butyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116949489) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-[1,4-bis(methylamino)butyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[1,4-bis(methylamino)butyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116949489 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 6-[1,4-bis(methylamino)butyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CNCCCC(NC)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C14H21N3O2/c1-15-8-4-5-11(16-2)10-6-7-12-13(9-10)19-14(18)17(12)3/h6-7,9,11,15-16H,4-5,8H2,1-3H3 |
| InChIKey | CSFYQMYUKKUPKN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|