C11H14N2O2S — CID 116830693
3-methyl-6-[1-(methylamino)-2-sulfanylethyl]-1,3-benzoxazol-2-one (PubChem CID 116830693) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-methyl-6-[1-(methylamino)-2-sulfanylethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[1-(methylamino)-2-sulfanylethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116830693 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-methyl-6-[1-(methylamino)-2-sulfanylethyl]-1,3-benzoxazol-2-one |
| SMILES | CNC(CS)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C11H14N2O2S/c1-12-8(6-16)7-3-4-9-10(5-7)15-11(14)13(9)2/h3-5,8,12,16H,6H2,1-2H3 |
| InChIKey | ZZWDKSARGCACQC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|