C12H18Cl2N2 — CID 116949498
1-(3,4-dichlorophenyl)-N,N'-dimethylbutane-1,4-diamine (PubChem CID 116949498) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N,N'-dimethylbutane-1,4-diamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N,N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949498 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N,N'-dimethylbutane-1,4-diamine |
| SMILES | CNCCCC(NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2/c1-15-7-3-4-12(16-2)9-5-6-10(13)11(14)8-9/h5-6,8,12,15-16H,3-4,7H2,1-2H3 |
| InChIKey | ZLRJXCVIBBNUMZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|