C13H21ClN2O — CID 116948562
1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 116948562) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116948562 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CCOc1ccc(C(CCNC)NC)cc1Cl |
| InChI | InChI=1S/C13H21ClN2O/c1-4-17-13-6-5-10(9-11(13)14)12(16-3)7-8-15-2/h5-6,9,12,15-16H,4,7-8H2,1-3H3 |
| InChIKey | BXNIUSURUPFRHK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |