C12H19ClN2O — CID 116947925
1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 116947925) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 116947925 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(3-chloro-4-ethoxyphenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCOc1ccc(C(CNC)NC)cc1Cl |
| InChI | InChI=1S/C12H19ClN2O/c1-4-16-12-6-5-9(7-10(12)13)11(15-3)8-14-2/h5-7,11,14-15H,4,8H2,1-3H3 |
| InChIKey | LXKPKPPSQLGXNW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |