C11H15BrClNO — CID 116915052
1-bromo-1-(3-chloro-4-ethoxyphenyl)-N,N-dimethylmethanamine (PubChem CID 116915052) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is 1-bromo-1-(3-chloro-4-ethoxyphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-bromo-1-(3-chloro-4-ethoxyphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116915052 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 1-bromo-1-(3-chloro-4-ethoxyphenyl)-N,N-dimethylmethanamine |
| SMILES | CCOc1ccc(C(Br)N(C)C)cc1Cl |
| InChI | InChI=1S/C11H15BrClNO/c1-4-15-10-6-5-8(7-9(10)13)11(12)14(2)3/h5-7,11H,4H2,1-3H3 |
| InChIKey | WRWKLWDPRGZNAL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|