C10H14Cl2N2 — CID 116947987
1-(3,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 116947987) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 116947987 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCC(NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2/c1-13-6-10(14-2)7-3-4-8(11)9(12)5-7/h3-5,10,13-14H,6H2,1-2H3 |
| InChIKey | KZNDZBSZCUGWPS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |