C10H13Cl2N — CID 43486460
1-(3,4-dichlorophenyl)-N-methylpropan-1-amine (PubChem CID 43486460) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methylpropan-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 43486460 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2N/c1-3-10(13-2)7-4-5-8(11)9(12)6-7/h4-6,10,13H,3H2,1-2H3 |
| InChIKey | QSZZNBOQUYJDGU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |