C12H17Cl2N — CID 43756202
1-(3,4-dichlorophenyl)-N-propan-2-ylpropan-1-amine (PubChem CID 43756202) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 43756202 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-propan-2-ylpropan-1-amine |
| SMILES | CCC(NC(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N/c1-4-12(15-8(2)3)9-5-6-10(13)11(14)7-9/h5-8,12,15H,4H2,1-3H3 |
| InChIKey | VAIOYUGKYJXKAC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |