C10H12Cl2 — CID 118120399
4-[(2R)-butan-2-yl]-1,2-dichlorobenzene (PubChem CID 118120399) has the molecular formula C10H12Cl2 and a molecular weight of 203.11 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]-1,2-dichlorobenzene.
| Compound Name | 4-[(2R)-butan-2-yl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 118120399 |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 4-[(2R)-butan-2-yl]-1,2-dichlorobenzene |
| SMILES | CC[C@@H](C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2/c1-3-7(2)8-4-5-9(11)10(12)6-8/h4-7H,3H2,1-2H3/t7-/m1/s1 |
| InChIKey | VXHOYXRMOOUWNP-SSDOTTSWSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |