C10H13Cl2N — CID 116914680
1-(3,4-dichlorophenyl)-N,N-dimethylethanamine (PubChem CID 116914680) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N,N-dimethylethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 116914680 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N,N-dimethylethanamine |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)N(C)C |
| InChI | InChI=1S/C10H13Cl2N/c1-7(13(2)3)8-4-5-9(11)10(12)6-8/h4-7H,1-3H3 |
| InChIKey | IUCNCZSIZLTSFY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |