C11H15Cl2NO — CID 83931252
3-(3,4-dichlorophenyl)-3-(dimethylamino)propan-1-ol (PubChem CID 83931252) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(dimethylamino)propan-1-ol.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(dimethylamino)propan-1-ol |
|---|---|
| PubChem CID | 83931252 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(dimethylamino)propan-1-ol |
| SMILES | CN(C)C(CCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2NO/c1-14(2)11(5-6-15)8-3-4-9(12)10(13)7-8/h3-4,7,11,15H,5-6H2,1-2H3 |
| InChIKey | YEXTWUJWIPPVFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |