C10H13Cl2NO — CID 64814917
3-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol (PubChem CID 64814917) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 64814917 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol |
| SMILES | CNC(CCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2NO/c1-13-10(4-5-14)7-2-3-8(11)9(12)6-7/h2-3,6,10,13-14H,4-5H2,1H3 |
| InChIKey | QGJJAVAFGRUZMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |