C18H21Cl2NO — CID 67925877
3-(3,4-dichlorophenyl)-3-(2-phenylpropylamino)propan-1-ol (PubChem CID 67925877) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(2-phenylpropylamino)propan-1-ol.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(2-phenylpropylamino)propan-1-ol |
|---|---|
| PubChem CID | 67925877 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(2-phenylpropylamino)propan-1-ol |
| SMILES | CC(CNC(CCO)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-13(14-5-3-2-4-6-14)12-21-18(9-10-22)15-7-8-16(19)17(20)11-15/h2-8,11,13,18,21-22H,9-10,12H2,1H3 |
| InChIKey | ZOGQRHQDFRWQDD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |